C16H13NO7S2 — CID 87973150
1-(4-hydroxy-2-sulfoanilino)naphthalene-2-sulfonic acid (PubChem CID 87973150) has the molecular formula C16H13NO7S2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 1-(4-hydroxy-2-sulfoanilino)naphthalene-2-sulfonic acid.
| Compound Name | 1-(4-hydroxy-2-sulfoanilino)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 87973150 |
| Molecular Formula | C16H13NO7S2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 1-(4-hydroxy-2-sulfoanilino)naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)ccc1Nc1c(S(=O)(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C16H13NO7S2/c18-11-6-7-13(15(9-11)26(22,23)24)17-16-12-4-2-1-3-10(12)5-8-14(16)25(19,20)21/h1-9,17-18H,(H,19,20,21)(H,22,23,24) |
| InChIKey | PRRMDFRUNOWHHX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|