C20H16O4 — CID 67516588
naphthalene-1,4-diol;naphthalene-2,6-diol (PubChem CID 67516588) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is naphthalene-1,4-diol;naphthalene-2,6-diol.
| Compound Name | naphthalene-1,4-diol;naphthalene-2,6-diol |
|---|---|
| PubChem CID | 67516588 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | naphthalene-1,4-diol;naphthalene-2,6-diol |
| SMILES | Oc1ccc(O)c2ccccc12.Oc1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/2C10H8O2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h2*1-6,11-12H |
| InChIKey | BZIFQJANGTVYFE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|