C26H17Cl5O3 — CID 161098712
1-chloronaphthalen-2-ol;naphthalen-2-ol;2,3,4,5-tetrachlorophenol (PubChem CID 161098712) has the molecular formula C26H17Cl5O3 and a molecular weight of 554.68 g/mol. Its IUPAC name is 1-chloronaphthalen-2-ol;naphthalen-2-ol;2,3,4,5-tetrachlorophenol.
| Compound Name | 1-chloronaphthalen-2-ol;naphthalen-2-ol;2,3,4,5-tetrachlorophenol |
|---|---|
| PubChem CID | 161098712 |
| Molecular Formula | C26H17Cl5O3 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 551.96 |
| IUPAC Name | 1-chloronaphthalen-2-ol;naphthalen-2-ol;2,3,4,5-tetrachlorophenol |
| SMILES | Oc1cc(Cl)c(Cl)c(Cl)c1Cl.Oc1ccc2ccccc2c1.Oc1ccc2ccccc2c1Cl |
| InChI | InChI=1S/C10H7ClO.C10H8O.C6H2Cl4O/c11-10-8-4-2-1-3-7(8)5-6-9(10)12;11-10-6-5-8-3-1-2-4-9(8)7-10;7-2-1-3(11)5(9)6(10)4(2)8/h1-6,12H;1-7,11H;1,11H |
| InChIKey | UIDIBNJPWKULDW-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|