About 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol
1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol (PubChem CID 162230418) has the molecular formula C25H24ClNO2
and a molecular weight of 405.93 g/mol. Its IUPAC name is 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol |
| PubChem CID | 162230418 |
| Molecular Formula | C25H24ClNO2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol |
| SMILES | Oc1cc(N2CCCCC2)c2ccccc2c1Cl.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16ClNO.C10H8O/c16-15-12-7-3-2-6-11(12)13(10-14(15)18)17-8-4-1-5-9-17;11-10-6-5-8-3-1-2-4-9(8)7-10/h2-3,6-7,10,18H,1,4-5,8-9H2;1-7,11H |
| InChIKey | ZVIPDOPPIQQHDT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol?
The IUPAC name of 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol (CID 162230418) is 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol.
What is the SMILES notation for 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol?
The canonical SMILES for 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol is Oc1cc(N2CCCCC2)c2ccccc2c1Cl.Oc1ccc2ccccc2c1.
What is the InChIKey of 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol?
The InChIKey is ZVIPDOPPIQQHDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO.C10H8O/c16-15-12-7-3-2-6-11(12)13(10-14(15)18)17-8-4-1-5-9-17;11-10-6-5-8-3-1-2-4-9(8)7-10/h2-3,6-7,10,18H,1,4-5,8-9H2;1-7,11H.
What are the key properties of 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol?
1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol has a molecular weight of 405.93 g/mol, XLogP of 6.73, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-piperidin-1-ylnaphthalen-2-ol;naphthalen-2-ol is sourced from PubChem (CID 162230418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).