C24H14Cl4 — CID 174900064
anthracene;1,2,3,4-tetrachloronaphthalene (PubChem CID 174900064) has the molecular formula C24H14Cl4 and a molecular weight of 444.19 g/mol. Its IUPAC name is anthracene;1,2,3,4-tetrachloronaphthalene.
| Compound Name | anthracene;1,2,3,4-tetrachloronaphthalene |
|---|---|
| PubChem CID | 174900064 |
| Molecular Formula | C24H14Cl4 |
| Molecular Weight | 444.19 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | anthracene;1,2,3,4-tetrachloronaphthalene |
| SMILES | Clc1c(Cl)c(Cl)c2ccccc2c1Cl.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C10H4Cl4/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;11-7-5-3-1-2-4-6(5)8(12)10(14)9(7)13/h1-10H;1-4H |
| InChIKey | DFYVVGVPOIHSHX-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.19 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|