C18H10Cl2 — CID 87498157
5,12-dichlorotetracene (PubChem CID 87498157) has the molecular formula C18H10Cl2 and a molecular weight of 297.18 g/mol. Its IUPAC name is 5,12-dichlorotetracene.
| Compound Name | 5,12-dichlorotetracene |
|---|---|
| PubChem CID | 87498157 |
| Molecular Formula | C18H10Cl2 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 5,12-dichlorotetracene |
| SMILES | Clc1c2ccccc2c(Cl)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C18H10Cl2/c19-17-13-7-3-4-8-14(13)18(20)16-10-12-6-2-1-5-11(12)9-15(16)17/h1-10H |
| InChIKey | ABSKRMOZCDDGDC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|