C18H8Cl2F2 — CID 13419526
8,10-dichloro-9,11-difluorobenzo[a]anthracene (PubChem CID 13419526) has the molecular formula C18H8Cl2F2 and a molecular weight of 333.16 g/mol. Its IUPAC name is 8,10-dichloro-9,11-difluorobenzo[a]anthracene.
| Compound Name | 8,10-dichloro-9,11-difluorobenzo[a]anthracene |
|---|---|
| PubChem CID | 13419526 |
| Molecular Formula | C18H8Cl2F2 |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 8,10-dichloro-9,11-difluorobenzo[a]anthracene |
| SMILES | Fc1c(Cl)c(F)c2cc3c(ccc4ccccc43)cc2c1Cl |
| InChI | InChI=1S/C18H8Cl2F2/c19-15-13-7-10-6-5-9-3-1-2-4-11(9)12(10)8-14(13)17(21)16(20)18(15)22/h1-8H |
| InChIKey | DFFCQIQYRCRVRG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|