C14H7Cl3 — CID 123180958
1,2,10-trichloroanthracene (PubChem CID 123180958) has the molecular formula C14H7Cl3 and a molecular weight of 281.57 g/mol. Its IUPAC name is 1,2,10-trichloroanthracene.
| Compound Name | 1,2,10-trichloroanthracene |
|---|---|
| PubChem CID | 123180958 |
| Molecular Formula | C14H7Cl3 |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 1,2,10-trichloroanthracene |
| SMILES | Clc1ccc2c(Cl)c3ccccc3cc2c1Cl |
| InChI | InChI=1S/C14H7Cl3/c15-12-6-5-10-11(14(12)17)7-8-3-1-2-4-9(8)13(10)16/h1-7H |
| InChIKey | SZOYSRZXSQIJGS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|