C14H6Cl4 — CID 123825031
1,2,5,6-tetrachloroanthracene (PubChem CID 123825031) has the molecular formula C14H6Cl4 and a molecular weight of 316.01 g/mol. Its IUPAC name is 1,2,5,6-tetrachloroanthracene.
| Compound Name | 1,2,5,6-tetrachloroanthracene |
|---|---|
| PubChem CID | 123825031 |
| Molecular Formula | C14H6Cl4 |
| Molecular Weight | 316.01 g/mol |
| Exact Mass | 313.92 |
| IUPAC Name | 1,2,5,6-tetrachloroanthracene |
| SMILES | Clc1ccc2cc3c(Cl)c(Cl)ccc3cc2c1Cl |
| InChI | InChI=1S/C14H6Cl4/c15-11-3-1-7-5-10-8(6-9(7)13(11)17)2-4-12(16)14(10)18/h1-6H |
| InChIKey | KDESKANVMYVELW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.01 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|