C9H6Cl2O — CID 102472280
6,7-dichloro-2-methyl-1-benzofuran (PubChem CID 102472280) has the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. Its IUPAC name is 6,7-dichloro-2-methyl-1-benzofuran.
| Compound Name | 6,7-dichloro-2-methyl-1-benzofuran |
|---|---|
| PubChem CID | 102472280 |
| Molecular Formula | C9H6Cl2O |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 6,7-dichloro-2-methyl-1-benzofuran |
| SMILES | Cc1cc2ccc(Cl)c(Cl)c2o1 |
| InChI | InChI=1S/C9H6Cl2O/c1-5-4-6-2-3-7(10)8(11)9(6)12-5/h2-4H,1H3 |
| InChIKey | NEPQHJRALULSPA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |