C13H14Cl2O2 — CID 65426506
1-(6,7-dichloro-1-benzofuran-2-yl)-2,2-dimethylpropan-1-ol (PubChem CID 65426506) has the molecular formula C13H14Cl2O2 and a molecular weight of 273.16 g/mol. Its IUPAC name is 1-(6,7-dichloro-1-benzofuran-2-yl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(6,7-dichloro-1-benzofuran-2-yl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 65426506 |
| Molecular Formula | C13H14Cl2O2 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1-(6,7-dichloro-1-benzofuran-2-yl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)c1cc2ccc(Cl)c(Cl)c2o1 |
| InChI | InChI=1S/C13H14Cl2O2/c1-13(2,3)12(16)9-6-7-4-5-8(14)10(15)11(7)17-9/h4-6,12,16H,1-3H3 |
| InChIKey | ZDLNYQKXXJGEOP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |