C12H13Cl2NO — CID 65439823
1-(6,7-dichloro-1-benzofuran-2-yl)butan-1-amine (PubChem CID 65439823) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is 1-(6,7-dichloro-1-benzofuran-2-yl)butan-1-amine.
| Compound Name | 1-(6,7-dichloro-1-benzofuran-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 65439823 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-(6,7-dichloro-1-benzofuran-2-yl)butan-1-amine |
| SMILES | CCCC(N)c1cc2ccc(Cl)c(Cl)c2o1 |
| InChI | InChI=1S/C12H13Cl2NO/c1-2-3-9(15)10-6-7-4-5-8(13)11(14)12(7)16-10/h4-6,9H,2-3,15H2,1H3 |
| InChIKey | ABLXXTVJRFDPGZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |