C11H11Cl2NO — CID 65440531
1-(6,7-dichloro-1-benzofuran-2-yl)-N-methylethanamine (PubChem CID 65440531) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is 1-(6,7-dichloro-1-benzofuran-2-yl)-N-methylethanamine.
| Compound Name | 1-(6,7-dichloro-1-benzofuran-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 65440531 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 1-(6,7-dichloro-1-benzofuran-2-yl)-N-methylethanamine |
| SMILES | CNC(C)c1cc2ccc(Cl)c(Cl)c2o1 |
| InChI | InChI=1S/C11H11Cl2NO/c1-6(14-2)9-5-7-3-4-8(12)10(13)11(7)15-9/h3-6,14H,1-2H3 |
| InChIKey | RLITZSHYVVAGKJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |