About 2-chlorotetracen-1-amine
2-chlorotetracen-1-amine (PubChem CID 175491990) has the molecular formula C18H12ClN
and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-chlorotetracen-1-amine.
Molecular Properties
| Compound Name | 2-chlorotetracen-1-amine |
| PubChem CID | 175491990 |
| Molecular Formula | C18H12ClN |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-chlorotetracen-1-amine |
| SMILES | Nc1c(Cl)ccc2cc3cc4ccccc4cc3cc12 |
| InChI | InChI=1S/C18H12ClN/c19-17-6-5-13-9-14-7-11-3-1-2-4-12(11)8-15(14)10-16(13)18(17)20/h1-10H,20H2 |
| InChIKey | AZAYSRRXRHXUSB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorotetracen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorotetracen-1-amine?
The IUPAC name of 2-chlorotetracen-1-amine (CID 175491990) is 2-chlorotetracen-1-amine.
What is the SMILES notation for 2-chlorotetracen-1-amine?
The canonical SMILES for 2-chlorotetracen-1-amine is Nc1c(Cl)ccc2cc3cc4ccccc4cc3cc12.
What is the InChIKey of 2-chlorotetracen-1-amine?
The InChIKey is AZAYSRRXRHXUSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClN/c19-17-6-5-13-9-14-7-11-3-1-2-4-12(11)8-15(14)10-16(13)18(17)20/h1-10H,20H2.
What are the key properties of 2-chlorotetracen-1-amine?
2-chlorotetracen-1-amine has a molecular weight of 277.75 g/mol, XLogP of 5.38, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorotetracen-1-amine is sourced from PubChem (CID 175491990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).