About 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol
1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol (PubChem CID 159654174) has the molecular formula C28H29ClN2O4
and a molecular weight of 493.00 g/mol. Its IUPAC name is 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol.
Molecular Properties
| Compound Name | 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol |
| PubChem CID | 159654174 |
| Molecular Formula | C28H29ClN2O4 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol |
| SMILES | Oc1cc(N2CCOCC2)c2ccccc2c1.Oc1cc(N2CCOCC2)c2ccccc2c1Cl |
| InChI | InChI=1S/C14H14ClNO2.C14H15NO2/c15-14-11-4-2-1-3-10(11)12(9-13(14)17)16-5-7-18-8-6-16;16-12-9-11-3-1-2-4-13(11)14(10-12)15-5-7-17-8-6-15/h1-4,9,17H,5-8H2;1-4,9-10,16H,5-8H2 |
| InChIKey | MRYRPFWVGKXPOV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol?
The IUPAC name of 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol (CID 159654174) is 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol.
What is the SMILES notation for 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol?
The canonical SMILES for 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol is Oc1cc(N2CCOCC2)c2ccccc2c1.Oc1cc(N2CCOCC2)c2ccccc2c1Cl.
What is the InChIKey of 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol?
The InChIKey is MRYRPFWVGKXPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO2.C14H15NO2/c15-14-11-4-2-1-3-10(11)12(9-13(14)17)16-5-7-18-8-6-16;16-12-9-11-3-1-2-4-13(11)14(10-12)15-5-7-17-8-6-15/h1-4,9,17H,5-8H2;1-4,9-10,16H,5-8H2.
What are the key properties of 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol?
1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol has a molecular weight of 493.00 g/mol, XLogP of 5.42, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-morpholin-4-ylnaphthalen-2-ol;4-morpholin-4-ylnaphthalen-2-ol is sourced from PubChem (CID 159654174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).