C20H19N3O5S — CID 136845954
2-[(2-hydroxy-4-morpholin-4-ylnaphthalen-1-yl)diazenyl]benzenesulfonic acid (PubChem CID 136845954) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-[(2-hydroxy-4-morpholin-4-ylnaphthalen-1-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[(2-hydroxy-4-morpholin-4-ylnaphthalen-1-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136845954 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-[(2-hydroxy-4-morpholin-4-ylnaphthalen-1-yl)diazenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1/N=N/c1c(O)cc(N2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C20H19N3O5S/c24-18-13-17(23-9-11-28-12-10-23)14-5-1-2-6-15(14)20(18)22-21-16-7-3-4-8-19(16)29(25,26)27/h1-8,13,24H,9-12H2,(H,25,26,27)/b22-21+ |
| InChIKey | IEORFISWMNDXME-QURGRASLSA-N |
| XLogP | 4.04 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|