C12H6Cl6O2 — CID 166770259
2,3-dichlorophenol;2,3,4,5-tetrachlorophenol (PubChem CID 166770259) has the molecular formula C12H6Cl6O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is 2,3-dichlorophenol;2,3,4,5-tetrachlorophenol.
| Compound Name | 2,3-dichlorophenol;2,3,4,5-tetrachlorophenol |
|---|---|
| PubChem CID | 166770259 |
| Molecular Formula | C12H6Cl6O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 391.85 |
| IUPAC Name | 2,3-dichlorophenol;2,3,4,5-tetrachlorophenol |
| SMILES | Oc1cc(Cl)c(Cl)c(Cl)c1Cl.Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C6H2Cl4O.C6H4Cl2O/c7-2-1-3(11)5(9)6(10)4(2)8;7-4-2-1-3-5(9)6(4)8/h1,11H;1-3,9H |
| InChIKey | DIQDGHPXXBFSQN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|