C6H5BCl2F4N2O — CID 87667049
azanylidyneazanium;2,3-dichlorophenol;tetrafluoroborate (PubChem CID 87667049) has the molecular formula C6H5BCl2F4N2O and a molecular weight of 278.83 g/mol. Its IUPAC name is azanylidyneazanium;2,3-dichlorophenol;tetrafluoroborate.
| Compound Name | azanylidyneazanium;2,3-dichlorophenol;tetrafluoroborate |
|---|---|
| PubChem CID | 87667049 |
| Molecular Formula | C6H5BCl2F4N2O |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | azanylidyneazanium;2,3-dichlorophenol;tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[NH+].Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C6H4Cl2O.BF4.N2/c7-4-2-1-3-5(9)6(4)8;2-1(3,4)5;1-2/h1-3,9H;;/q;-1;/p+1 |
| InChIKey | OIGXCQBMKILQDV-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 67.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|