C6H3BCl2F3K — CID 63676783
potassium (2,3-dichlorophenyl)-trifluoroboranuide (PubChem CID 63676783) has the molecular formula C6H3BCl2F3K and a molecular weight of 252.90 g/mol. Its IUPAC name is potassium (2,3-dichlorophenyl)-trifluoroboranuide.
| Compound Name | potassium (2,3-dichlorophenyl)-trifluoroboranuide |
|---|---|
| PubChem CID | 63676783 |
| Molecular Formula | C6H3BCl2F3K |
| Molecular Weight | 252.90 g/mol |
| Exact Mass | 251.93 |
| IUPAC Name | potassium (2,3-dichlorophenyl)-trifluoroboranuide |
| SMILES | F[B-](F)(F)c1cccc(Cl)c1Cl.[K+] |
| InChI | InChI=1S/C6H3BCl2F3.K/c8-5-3-1-2-4(6(5)9)7(10,11)12;/h1-3H;/q-1;+1 |
| InChIKey | IDWIKDMIXJTBJV-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.90 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|