C6H5Cl2KO — CID 174676852
potassium;2,3-dichlorophenol;hydride (PubChem CID 174676852) has the molecular formula C6H5Cl2KO and a molecular weight of 203.11 g/mol. Its IUPAC name is potassium;2,3-dichlorophenol;hydride.
| Compound Name | potassium;2,3-dichlorophenol;hydride |
|---|---|
| PubChem CID | 174676852 |
| Molecular Formula | C6H5Cl2KO |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 201.94 |
| IUPAC Name | potassium;2,3-dichlorophenol;hydride |
| SMILES | Oc1cccc(Cl)c1Cl.[H-].[K+] |
| InChI | InChI=1S/C6H4Cl2O.K.H/c7-4-2-1-3-5(9)6(4)8;;/h1-3,9H;;/q;+1;-1 |
| InChIKey | XCQRTVNGRXUCRZ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |