About 2-chloro-3-methylphenol;ethane
2-chloro-3-methylphenol;ethane (PubChem CID 171645221) has the molecular formula C9H13ClO
and a molecular weight of 172.66 g/mol. Its IUPAC name is 2-chloro-3-methylphenol;ethane.
Molecular Properties
| Compound Name | 2-chloro-3-methylphenol;ethane |
| PubChem CID | 171645221 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-chloro-3-methylphenol;ethane |
| SMILES | CC.Cc1cccc(O)c1Cl |
| InChI | InChI=1S/C7H7ClO.C2H6/c1-5-3-2-4-6(9)7(5)8;1-2/h2-4,9H,1H3;1-2H3 |
| InChIKey | FIWZHDBQZNZBQS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-3-methylphenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methylphenol;ethane?
The IUPAC name of 2-chloro-3-methylphenol;ethane (CID 171645221) is 2-chloro-3-methylphenol;ethane.
What is the SMILES notation for 2-chloro-3-methylphenol;ethane?
The canonical SMILES for 2-chloro-3-methylphenol;ethane is CC.Cc1cccc(O)c1Cl.
What is the InChIKey of 2-chloro-3-methylphenol;ethane?
The InChIKey is FIWZHDBQZNZBQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO.C2H6/c1-5-3-2-4-6(9)7(5)8;1-2/h2-4,9H,1H3;1-2H3.
What are the key properties of 2-chloro-3-methylphenol;ethane?
2-chloro-3-methylphenol;ethane has a molecular weight of 172.66 g/mol, XLogP of 3.38, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methylphenol;ethane is sourced from PubChem (CID 171645221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).