About 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol
2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol (PubChem CID 174431757) has the molecular formula C27H26Cl4O4
and a molecular weight of 556.31 g/mol. Its IUPAC name is 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol.
Molecular Properties
| Compound Name | 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol |
| PubChem CID | 174431757 |
| Molecular Formula | C27H26Cl4O4 |
| Molecular Weight | 556.31 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol |
| SMILES | CCc1cccc(O)c1Cl.Cc1cccc(O)c1Cl.Oc1ccc(Cl)cc1.Oc1ccccc1Cl |
| InChI | InChI=1S/C8H9ClO.C7H7ClO.2C6H5ClO/c1-2-6-4-3-5-7(10)8(6)9;1-5-3-2-4-6(9)7(5)8;7-5-1-3-6(8)4-2-5;7-5-3-1-2-4-6(5)8/h3-5,10H,2H2,1H3;2-4,9H,1H3;2*1-4,8H |
| InChIKey | LXFKWZSKNANISV-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.31 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol?
The IUPAC name of 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol (CID 174431757) is 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol.
What is the SMILES notation for 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol?
The canonical SMILES for 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol is CCc1cccc(O)c1Cl.Cc1cccc(O)c1Cl.Oc1ccc(Cl)cc1.Oc1ccccc1Cl.
What is the InChIKey of 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol?
The InChIKey is LXFKWZSKNANISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO.C7H7ClO.2C6H5ClO/c1-2-6-4-3-5-7(10)8(6)9;1-5-3-2-4-6(9)7(5)8;7-5-1-3-6(8)4-2-5;7-5-3-1-2-4-6(5)8/h3-5,10H,2H2,1H3;2-4,9H,1H3;2*1-4,8H.
What are the key properties of 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol?
2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol has a molecular weight of 556.31 g/mol, XLogP of 9.05, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-ethylphenol;2-chloro-3-methylphenol;2-chlorophenol;4-chlorophenol is sourced from PubChem (CID 174431757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).