About 4-chlorophenol;methoxymethane
4-chlorophenol;methoxymethane (PubChem CID 23617160) has the molecular formula C8H11ClO2
and a molecular weight of 174.63 g/mol. Its IUPAC name is 4-chlorophenol;methoxymethane.
Molecular Properties
| Compound Name | 4-chlorophenol;methoxymethane |
| PubChem CID | 23617160 |
| Molecular Formula | C8H11ClO2 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 4-chlorophenol;methoxymethane |
| SMILES | COC.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H5ClO.C2H6O/c7-5-1-3-6(8)4-2-5;1-3-2/h1-4,8H;1-2H3 |
| InChIKey | VZAQPLDBUWBXMH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chlorophenol;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorophenol;methoxymethane?
The IUPAC name of 4-chlorophenol;methoxymethane (CID 23617160) is 4-chlorophenol;methoxymethane.
What is the SMILES notation for 4-chlorophenol;methoxymethane?
The canonical SMILES for 4-chlorophenol;methoxymethane is COC.Oc1ccc(Cl)cc1.
What is the InChIKey of 4-chlorophenol;methoxymethane?
The InChIKey is VZAQPLDBUWBXMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO.C2H6O/c7-5-1-3-6(8)4-2-5;1-3-2/h1-4,8H;1-2H3.
What are the key properties of 4-chlorophenol;methoxymethane?
4-chlorophenol;methoxymethane has a molecular weight of 174.63 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorophenol;methoxymethane is sourced from PubChem (CID 23617160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).