About 4-chlorophenol;prop-1-ene
4-chlorophenol;prop-1-ene (PubChem CID 158486029) has the molecular formula C9H11ClO
and a molecular weight of 170.64 g/mol. Its IUPAC name is 4-chlorophenol;prop-1-ene.
Molecular Properties
| Compound Name | 4-chlorophenol;prop-1-ene |
| PubChem CID | 158486029 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 4-chlorophenol;prop-1-ene |
| SMILES | C=CC.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H5ClO.C3H6/c7-5-1-3-6(8)4-2-5;1-3-2/h1-4,8H;3H,1H2,2H3 |
| InChIKey | HICMPGFQHRHSAL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorophenol;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorophenol;prop-1-ene?
The IUPAC name of 4-chlorophenol;prop-1-ene (CID 158486029) is 4-chlorophenol;prop-1-ene.
What is the SMILES notation for 4-chlorophenol;prop-1-ene?
The canonical SMILES for 4-chlorophenol;prop-1-ene is C=CC.Oc1ccc(Cl)cc1.
What is the InChIKey of 4-chlorophenol;prop-1-ene?
The InChIKey is HICMPGFQHRHSAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO.C3H6/c7-5-1-3-6(8)4-2-5;1-3-2/h1-4,8H;3H,1H2,2H3.
What are the key properties of 4-chlorophenol;prop-1-ene?
4-chlorophenol;prop-1-ene has a molecular weight of 170.64 g/mol, XLogP of 3.24, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorophenol;prop-1-ene is sourced from PubChem (CID 158486029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).