About (4-chlorophenyl)methanol;4-methylphenol
(4-chlorophenyl)methanol;4-methylphenol (PubChem CID 158049041) has the molecular formula C14H15ClO2
and a molecular weight of 250.72 g/mol. Its IUPAC name is (4-chlorophenyl)methanol;4-methylphenol.
Molecular Properties
| Compound Name | (4-chlorophenyl)methanol;4-methylphenol |
| PubChem CID | 158049041 |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.72 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (4-chlorophenyl)methanol;4-methylphenol |
| SMILES | Cc1ccc(O)cc1.OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H7ClO.C7H8O/c8-7-3-1-6(5-9)2-4-7;1-6-2-4-7(8)5-3-6/h1-4,9H,5H2;2-5,8H,1H3 |
| InChIKey | FJGKEFQSYUMQAU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)methanol;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methanol;4-methylphenol?
The IUPAC name of (4-chlorophenyl)methanol;4-methylphenol (CID 158049041) is (4-chlorophenyl)methanol;4-methylphenol.
What is the SMILES notation for (4-chlorophenyl)methanol;4-methylphenol?
The canonical SMILES for (4-chlorophenyl)methanol;4-methylphenol is Cc1ccc(O)cc1.OCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methanol;4-methylphenol?
The InChIKey is FJGKEFQSYUMQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO.C7H8O/c8-7-3-1-6(5-9)2-4-7;1-6-2-4-7(8)5-3-6/h1-4,9H,5H2;2-5,8H,1H3.
What are the key properties of (4-chlorophenyl)methanol;4-methylphenol?
(4-chlorophenyl)methanol;4-methylphenol has a molecular weight of 250.72 g/mol, XLogP of 3.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methanol;4-methylphenol is sourced from PubChem (CID 158049041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).