About 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol
1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol (PubChem CID 157395568) has the molecular formula C16H19IO
and a molecular weight of 354.23 g/mol. Its IUPAC name is 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol.
Molecular Properties
| Compound Name | 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol |
| PubChem CID | 157395568 |
| Molecular Formula | C16H19IO |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol |
| SMILES | Cc1ccc(CI)cc1.Cc1ccc(CO)cc1 |
| InChI | InChI=1S/C8H9I.C8H10O/c2*1-7-2-4-8(6-9)5-3-7/h2-5H,6H2,1H3;2-5,9H,6H2,1H3 |
| InChIKey | BMNLFENMGNCVTG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol?
The IUPAC name of 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol (CID 157395568) is 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol.
What is the SMILES notation for 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol?
The canonical SMILES for 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol is Cc1ccc(CI)cc1.Cc1ccc(CO)cc1.
What is the InChIKey of 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol?
The InChIKey is BMNLFENMGNCVTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9I.C8H10O/c2*1-7-2-4-8(6-9)5-3-7/h2-5H,6H2,1H3;2-5,9H,6H2,1H3.
What are the key properties of 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol?
1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol has a molecular weight of 354.23 g/mol, XLogP of 4.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(iodomethyl)-4-methylbenzene;(4-methylphenyl)methanol is sourced from PubChem (CID 157395568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).