About 4-(iodomethyl)phenol
4-(iodomethyl)phenol (PubChem CID 11241787) has the molecular formula C7H7IO
and a molecular weight of 234.04 g/mol. Its IUPAC name is 4-(iodomethyl)phenol.
Molecular Properties
| Compound Name | 4-(iodomethyl)phenol |
| PubChem CID | 11241787 |
| Molecular Formula | C7H7IO |
| Molecular Weight | 234.04 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | 4-(iodomethyl)phenol |
| SMILES | Oc1ccc(CI)cc1 |
| InChI | InChI=1S/C7H7IO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H,5H2 |
| InChIKey | RMIYQPDJHYAGGW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.04 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(iodomethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(iodomethyl)phenol?
The IUPAC name of 4-(iodomethyl)phenol (CID 11241787) is 4-(iodomethyl)phenol.
What is the SMILES notation for 4-(iodomethyl)phenol?
The canonical SMILES for 4-(iodomethyl)phenol is Oc1ccc(CI)cc1.
What is the InChIKey of 4-(iodomethyl)phenol?
The InChIKey is RMIYQPDJHYAGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H,5H2.
What are the key properties of 4-(iodomethyl)phenol?
4-(iodomethyl)phenol has a molecular weight of 234.04 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(iodomethyl)phenol is sourced from PubChem (CID 11241787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).