About 4-(hydroxymethyl)phenol;hydrate
4-(hydroxymethyl)phenol;hydrate (PubChem CID 141133894) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 4-(hydroxymethyl)phenol;hydrate.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)phenol;hydrate |
| PubChem CID | 141133894 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 4-(hydroxymethyl)phenol;hydrate |
| SMILES | O.OCc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O2.H2O/c8-5-6-1-3-7(9)4-2-6;/h1-4,8-9H,5H2;1H2 |
| InChIKey | ACILMZPHMPXNDG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(hydroxymethyl)phenol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)phenol;hydrate?
The IUPAC name of 4-(hydroxymethyl)phenol;hydrate (CID 141133894) is 4-(hydroxymethyl)phenol;hydrate.
What is the SMILES notation for 4-(hydroxymethyl)phenol;hydrate?
The canonical SMILES for 4-(hydroxymethyl)phenol;hydrate is O.OCc1ccc(O)cc1.
What is the InChIKey of 4-(hydroxymethyl)phenol;hydrate?
The InChIKey is ACILMZPHMPXNDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.H2O/c8-5-6-1-3-7(9)4-2-6;/h1-4,8-9H,5H2;1H2.
What are the key properties of 4-(hydroxymethyl)phenol;hydrate?
4-(hydroxymethyl)phenol;hydrate has a molecular weight of 142.15 g/mol, XLogP of 0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)phenol;hydrate is sourced from PubChem (CID 141133894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).