About furan-2-ylmethanamine;4-(hydroxymethyl)phenol
furan-2-ylmethanamine;4-(hydroxymethyl)phenol (PubChem CID 175459572) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is furan-2-ylmethanamine;4-(hydroxymethyl)phenol.
Molecular Properties
| Compound Name | furan-2-ylmethanamine;4-(hydroxymethyl)phenol |
| PubChem CID | 175459572 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | furan-2-ylmethanamine;4-(hydroxymethyl)phenol |
| SMILES | NCc1ccco1.OCc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O2.C5H7NO/c8-5-6-1-3-7(9)4-2-6;6-4-5-2-1-3-7-5/h1-4,8-9H,5H2;1-3H,4,6H2 |
| InChIKey | CURCCYQNXWXRGY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furan-2-ylmethanamine;4-(hydroxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethanamine;4-(hydroxymethyl)phenol?
The IUPAC name of furan-2-ylmethanamine;4-(hydroxymethyl)phenol (CID 175459572) is furan-2-ylmethanamine;4-(hydroxymethyl)phenol.
What is the SMILES notation for furan-2-ylmethanamine;4-(hydroxymethyl)phenol?
The canonical SMILES for furan-2-ylmethanamine;4-(hydroxymethyl)phenol is NCc1ccco1.OCc1ccc(O)cc1.
What is the InChIKey of furan-2-ylmethanamine;4-(hydroxymethyl)phenol?
The InChIKey is CURCCYQNXWXRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.C5H7NO/c8-5-6-1-3-7(9)4-2-6;6-4-5-2-1-3-7-5/h1-4,8-9H,5H2;1-3H,4,6H2.
What are the key properties of furan-2-ylmethanamine;4-(hydroxymethyl)phenol?
furan-2-ylmethanamine;4-(hydroxymethyl)phenol has a molecular weight of 221.26 g/mol, XLogP of 1.62, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethanamine;4-(hydroxymethyl)phenol is sourced from PubChem (CID 175459572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).