About dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+)
dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+) (PubChem CID 20687675) has the molecular formula C9H16O2SiTi
and a molecular weight of 232.18 g/mol. Its IUPAC name is dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+).
Molecular Properties
| Compound Name | dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+) |
| PubChem CID | 20687675 |
| Molecular Formula | C9H16O2SiTi |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+) |
| SMILES | OCc1ccco1.[CH2-][Si]([CH2-])(C)C.[Ti+2] |
| InChI | InChI=1S/C5H6O2.C4H10Si.Ti/c6-4-5-2-1-3-7-5;1-5(2,3)4;/h1-3,6H,4H2;1-2H2,3-4H3;/q;-2;+2 |
| InChIKey | PDLQSRRXBPLNRA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+)?
The IUPAC name of dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+) (CID 20687675) is dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+).
What is the SMILES notation for dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+)?
The canonical SMILES for dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+) is OCc1ccco1.[CH2-][Si]([CH2-])(C)C.[Ti+2].
What is the InChIKey of dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+)?
The InChIKey is PDLQSRRXBPLNRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O2.C4H10Si.Ti/c6-4-5-2-1-3-7-5;1-5(2,3)4;/h1-3,6H,4H2;1-2H2,3-4H3;/q;-2;+2.
What are the key properties of dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+)?
dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+) has a molecular weight of 232.18 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethanidyl(dimethyl)silane;furan-2-ylmethanol;titanium(2+) is sourced from PubChem (CID 20687675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).