About furan-2-ylmethanol;2-propan-2-ylsulfanylpropane
furan-2-ylmethanol;2-propan-2-ylsulfanylpropane (PubChem CID 174913675) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is furan-2-ylmethanol;2-propan-2-ylsulfanylpropane.
Molecular Properties
| Compound Name | furan-2-ylmethanol;2-propan-2-ylsulfanylpropane |
| PubChem CID | 174913675 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | furan-2-ylmethanol;2-propan-2-ylsulfanylpropane |
| SMILES | CC(C)SC(C)C.OCc1ccco1 |
| InChI | InChI=1S/C6H14S.C5H6O2/c1-5(2)7-6(3)4;6-4-5-2-1-3-7-5/h5-6H,1-4H3;1-3,6H,4H2 |
| InChIKey | FUUXEHFTPFIIFT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-2-ylmethanol;2-propan-2-ylsulfanylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethanol;2-propan-2-ylsulfanylpropane?
The IUPAC name of furan-2-ylmethanol;2-propan-2-ylsulfanylpropane (CID 174913675) is furan-2-ylmethanol;2-propan-2-ylsulfanylpropane.
What is the SMILES notation for furan-2-ylmethanol;2-propan-2-ylsulfanylpropane?
The canonical SMILES for furan-2-ylmethanol;2-propan-2-ylsulfanylpropane is CC(C)SC(C)C.OCc1ccco1.
What is the InChIKey of furan-2-ylmethanol;2-propan-2-ylsulfanylpropane?
The InChIKey is FUUXEHFTPFIIFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S.C5H6O2/c1-5(2)7-6(3)4;6-4-5-2-1-3-7-5/h5-6H,1-4H3;1-3,6H,4H2.
What are the key properties of furan-2-ylmethanol;2-propan-2-ylsulfanylpropane?
furan-2-ylmethanol;2-propan-2-ylsulfanylpropane has a molecular weight of 216.35 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethanol;2-propan-2-ylsulfanylpropane is sourced from PubChem (CID 174913675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).