About furan-2-ylmethanol;4-oxopentanoic acid
furan-2-ylmethanol;4-oxopentanoic acid (PubChem CID 174653424) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is furan-2-ylmethanol;4-oxopentanoic acid.
Molecular Properties
| Compound Name | furan-2-ylmethanol;4-oxopentanoic acid |
| PubChem CID | 174653424 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | furan-2-ylmethanol;4-oxopentanoic acid |
| SMILES | CC(=O)CCC(=O)O.OCc1ccco1 |
| InChI | InChI=1S/C5H8O3.C5H6O2/c1-4(6)2-3-5(7)8;6-4-5-2-1-3-7-5/h2-3H2,1H3,(H,7,8);1-3,6H,4H2 |
| InChIKey | XPSIWAAQHOHBGW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furan-2-ylmethanol;4-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethanol;4-oxopentanoic acid?
The IUPAC name of furan-2-ylmethanol;4-oxopentanoic acid (CID 174653424) is furan-2-ylmethanol;4-oxopentanoic acid.
What is the SMILES notation for furan-2-ylmethanol;4-oxopentanoic acid?
The canonical SMILES for furan-2-ylmethanol;4-oxopentanoic acid is CC(=O)CCC(=O)O.OCc1ccco1.
What is the InChIKey of furan-2-ylmethanol;4-oxopentanoic acid?
The InChIKey is XPSIWAAQHOHBGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.C5H6O2/c1-4(6)2-3-5(7)8;6-4-5-2-1-3-7-5/h2-3H2,1H3,(H,7,8);1-3,6H,4H2.
What are the key properties of furan-2-ylmethanol;4-oxopentanoic acid?
furan-2-ylmethanol;4-oxopentanoic acid has a molecular weight of 214.22 g/mol, XLogP of 1.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethanol;4-oxopentanoic acid is sourced from PubChem (CID 174653424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).