About furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol
furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol (PubChem CID 174941274) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol.
Molecular Properties
| Compound Name | furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol |
| PubChem CID | 174941274 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol |
| SMILES | OCc1ccc(CO)o1.OCc1ccco1 |
| InChI | InChI=1S/C6H8O3.C5H6O2/c7-3-5-1-2-6(4-8)9-5;6-4-5-2-1-3-7-5/h1-2,7-8H,3-4H2;1-3,6H,4H2 |
| InChIKey | MKZZSZGVNGAZHQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol?
The IUPAC name of furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol (CID 174941274) is furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol.
What is the SMILES notation for furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol?
The canonical SMILES for furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol is OCc1ccc(CO)o1.OCc1ccco1.
What is the InChIKey of furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol?
The InChIKey is MKZZSZGVNGAZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3.C5H6O2/c7-3-5-1-2-6(4-8)9-5;6-4-5-2-1-3-7-5/h1-2,7-8H,3-4H2;1-3,6H,4H2.
What are the key properties of furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol?
furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol has a molecular weight of 226.23 g/mol, XLogP of 1.04, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethanol;[5-(hydroxymethyl)furan-2-yl]methanol is sourced from PubChem (CID 174941274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).