About azane;(5-methylfuran-2-yl)methanol
azane;(5-methylfuran-2-yl)methanol (PubChem CID 175565780) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is azane;(5-methylfuran-2-yl)methanol.
Molecular Properties
| Compound Name | azane;(5-methylfuran-2-yl)methanol |
| PubChem CID | 175565780 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | azane;(5-methylfuran-2-yl)methanol |
| SMILES | Cc1ccc(CO)o1.N |
| InChI | InChI=1S/C6H8O2.H3N/c1-5-2-3-6(4-7)8-5;/h2-3,7H,4H2,1H3;1H3 |
| InChIKey | VSTBCXYHCJVTRT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;(5-methylfuran-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(5-methylfuran-2-yl)methanol?
The IUPAC name of azane;(5-methylfuran-2-yl)methanol (CID 175565780) is azane;(5-methylfuran-2-yl)methanol.
What is the SMILES notation for azane;(5-methylfuran-2-yl)methanol?
The canonical SMILES for azane;(5-methylfuran-2-yl)methanol is Cc1ccc(CO)o1.N.
What is the InChIKey of azane;(5-methylfuran-2-yl)methanol?
The InChIKey is VSTBCXYHCJVTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.H3N/c1-5-2-3-6(4-7)8-5;/h2-3,7H,4H2,1H3;1H3.
What are the key properties of azane;(5-methylfuran-2-yl)methanol?
azane;(5-methylfuran-2-yl)methanol has a molecular weight of 129.16 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(5-methylfuran-2-yl)methanol is sourced from PubChem (CID 175565780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).