C8H14O2 — CID 160667580
2,5-dimethylfuran;ethanol (PubChem CID 160667580) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 2,5-dimethylfuran;ethanol.
| Compound Name | 2,5-dimethylfuran;ethanol |
|---|---|
| PubChem CID | 160667580 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2,5-dimethylfuran;ethanol |
| SMILES | CCO.Cc1ccc(C)o1 |
| InChI | InChI=1S/C6H8O.C2H6O/c1-5-3-4-6(2)7-5;1-2-3/h3-4H,1-2H3;3H,2H2,1H3 |
| InChIKey | RMMXESIFPAGVPR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |