C9H14O3 — CID 116861366
1-(5-methylfuran-2-yl)butane-1,4-diol (PubChem CID 116861366) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-(5-methylfuran-2-yl)butane-1,4-diol.
| Compound Name | 1-(5-methylfuran-2-yl)butane-1,4-diol |
|---|---|
| PubChem CID | 116861366 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-(5-methylfuran-2-yl)butane-1,4-diol |
| SMILES | Cc1ccc(C(O)CCCO)o1 |
| InChI | InChI=1S/C9H14O3/c1-7-4-5-9(12-7)8(11)3-2-6-10/h4-5,8,10-11H,2-3,6H2,1H3 |
| InChIKey | AUFJAYODJXKWOU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |