C10H13N3O2 — CID 107045816
1-(5-methylfuran-2-yl)-2-(1-methyltriazol-4-yl)ethanol (PubChem CID 107045816) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-(5-methylfuran-2-yl)-2-(1-methyltriazol-4-yl)ethanol.
| Compound Name | 1-(5-methylfuran-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
|---|---|
| PubChem CID | 107045816 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-(5-methylfuran-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
| SMILES | Cc1ccc(C(O)Cc2cn(C)nn2)o1 |
| InChI | InChI=1S/C10H13N3O2/c1-7-3-4-10(15-7)9(14)5-8-6-13(2)12-11-8/h3-4,6,9,14H,5H2,1-2H3 |
| InChIKey | HNEAVQOGKSAWCC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |