C9H10ClN3OS — CID 107045954
1-(5-chlorothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol (PubChem CID 107045954) has the molecular formula C9H10ClN3OS and a molecular weight of 243.72 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
|---|---|
| PubChem CID | 107045954 |
| Molecular Formula | C9H10ClN3OS |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
| SMILES | Cn1cc(CC(O)c2ccc(Cl)s2)nn1 |
| InChI | InChI=1S/C9H10ClN3OS/c1-13-5-6(11-12-13)4-7(14)8-2-3-9(10)15-8/h2-3,5,7,14H,4H2,1H3 |
| InChIKey | QCXVOTGANXWYOM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |