C8H10N4OS — CID 107046422
2-(1-methyltriazol-4-yl)-1-(1,3-thiazol-4-yl)ethanol (PubChem CID 107046422) has the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. Its IUPAC name is 2-(1-methyltriazol-4-yl)-1-(1,3-thiazol-4-yl)ethanol.
| Compound Name | 2-(1-methyltriazol-4-yl)-1-(1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 107046422 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-(1-methyltriazol-4-yl)-1-(1,3-thiazol-4-yl)ethanol |
| SMILES | Cn1cc(CC(O)c2cscn2)nn1 |
| InChI | InChI=1S/C8H10N4OS/c1-12-3-6(10-11-12)2-8(13)7-4-14-5-9-7/h3-5,8,13H,2H2,1H3 |
| InChIKey | KUABXIZIYYXASH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |