C7H13N3O2 — CID 107058357
2-[(1-methyltriazol-4-yl)methyl]propane-1,3-diol (PubChem CID 107058357) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-[(1-methyltriazol-4-yl)methyl]propane-1,3-diol.
| Compound Name | 2-[(1-methyltriazol-4-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 107058357 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 2-[(1-methyltriazol-4-yl)methyl]propane-1,3-diol |
| SMILES | Cn1cc(CC(CO)CO)nn1 |
| InChI | InChI=1S/C7H13N3O2/c1-10-3-7(8-9-10)2-6(4-11)5-12/h3,6,11-12H,2,4-5H2,1H3 |
| InChIKey | JPNNBZKWUZZGSP-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |