C12H22N4O3 — CID 107053943
tert-butyl N-[2-(hydroxymethyl)-3-(1-methyltriazol-4-yl)propyl]carbamate (PubChem CID 107053943) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-3-(1-methyltriazol-4-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-3-(1-methyltriazol-4-yl)propyl]carbamate |
|---|---|
| PubChem CID | 107053943 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-3-(1-methyltriazol-4-yl)propyl]carbamate |
| SMILES | Cn1cc(CC(CO)CNC(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C12H22N4O3/c1-12(2,3)19-11(18)13-6-9(8-17)5-10-7-16(4)15-14-10/h7,9,17H,5-6,8H2,1-4H3,(H,13,18) |
| InChIKey | MIRDKQOAEVKQSA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |