C10H19N5O2 — CID 130598570
tert-butyl N-[2-amino-1-(1-methyltriazol-4-yl)ethyl]carbamate (PubChem CID 130598570) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl N-[2-amino-1-(1-methyltriazol-4-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-1-(1-methyltriazol-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 130598570 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | tert-butyl N-[2-amino-1-(1-methyltriazol-4-yl)ethyl]carbamate |
| SMILES | Cn1cc(C(CN)NC(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C10H19N5O2/c1-10(2,3)17-9(16)12-7(5-11)8-6-15(4)14-13-8/h6-7H,5,11H2,1-4H3,(H,12,16) |
| InChIKey | ZSFGQNCFIFAFRO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |