C12H20N4O4 — CID 114703660
tert-butyl N-[1-[3-(2-amino-2-oxoethyl)imidazol-4-yl]-2-hydroxyethyl]carbamate (PubChem CID 114703660) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(2-amino-2-oxoethyl)imidazol-4-yl]-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(2-amino-2-oxoethyl)imidazol-4-yl]-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 114703660 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | tert-butyl N-[1-[3-(2-amino-2-oxoethyl)imidazol-4-yl]-2-hydroxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)c1cncn1CC(N)=O |
| InChI | InChI=1S/C12H20N4O4/c1-12(2,3)20-11(19)15-8(6-17)9-4-14-7-16(9)5-10(13)18/h4,7-8,17H,5-6H2,1-3H3,(H2,13,18)(H,15,19) |
| InChIKey | JTVFNTRPRZIJAW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |