C12H22N4O2 — CID 114556265
tert-butyl N-[2-amino-1-(2-ethylpyrazol-3-yl)ethyl]carbamate (PubChem CID 114556265) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl N-[2-amino-1-(2-ethylpyrazol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-1-(2-ethylpyrazol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 114556265 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | tert-butyl N-[2-amino-1-(2-ethylpyrazol-3-yl)ethyl]carbamate |
| SMILES | CCn1nccc1C(CN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N4O2/c1-5-16-10(6-7-14-16)9(8-13)15-11(17)18-12(2,3)4/h6-7,9H,5,8,13H2,1-4H3,(H,15,17) |
| InChIKey | YBKFZMUWEDYHQI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |