C15H26BrN3O3 — CID 106508898
tert-butyl N-[2-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-3-hydroxypropyl]carbamate (PubChem CID 106508898) has the molecular formula C15H26BrN3O3 and a molecular weight of 376.30 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-3-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 106508898 |
| Molecular Formula | C15H26BrN3O3 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | tert-butyl N-[2-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-3-hydroxypropyl]carbamate |
| SMILES | CCc1nn(C)c(CC(CO)CNC(=O)OC(C)(C)C)c1Br |
| InChI | InChI=1S/C15H26BrN3O3/c1-6-11-13(16)12(19(5)18-11)7-10(9-20)8-17-14(21)22-15(2,3)4/h10,20H,6-9H2,1-5H3,(H,17,21) |
| InChIKey | FHHCUDDGCSTPJD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |