About 2,5-dimethylfuran;bis(pentane)
2,5-dimethylfuran;bis(pentane) (PubChem CID 142226685) has the molecular formula C16H32O
and a molecular weight of 240.43 g/mol. Its IUPAC name is 2,5-dimethylfuran;bis(pentane).
Molecular Properties
| Compound Name | 2,5-dimethylfuran;bis(pentane) |
| PubChem CID | 142226685 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 2,5-dimethylfuran;bis(pentane) |
| SMILES | CCCCC.CCCCC.Cc1ccc(C)o1 |
| InChI | InChI=1S/C6H8O.2C5H12/c1-5-3-4-6(2)7-5;2*1-3-5-4-2/h3-4H,1-2H3;2*3-5H2,1-2H3 |
| InChIKey | MFUWEZJJMZEYON-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethylfuran;bis(pentane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylfuran;bis(pentane)?
The IUPAC name of 2,5-dimethylfuran;bis(pentane) (CID 142226685) is 2,5-dimethylfuran;bis(pentane).
What is the SMILES notation for 2,5-dimethylfuran;bis(pentane)?
The canonical SMILES for 2,5-dimethylfuran;bis(pentane) is CCCCC.CCCCC.Cc1ccc(C)o1.
What is the InChIKey of 2,5-dimethylfuran;bis(pentane)?
The InChIKey is MFUWEZJJMZEYON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O.2C5H12/c1-5-3-4-6(2)7-5;2*1-3-5-4-2/h3-4H,1-2H3;2*3-5H2,1-2H3.
What are the key properties of 2,5-dimethylfuran;bis(pentane)?
2,5-dimethylfuran;bis(pentane) has a molecular weight of 240.43 g/mol, XLogP of 6.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylfuran;bis(pentane) is sourced from PubChem (CID 142226685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).