C19H29NO3 — CID 5171820
3-butoxy-N,N-bis[(5-methylfuran-2-yl)methyl]propan-1-amine (PubChem CID 5171820) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-butoxy-N,N-bis[(5-methylfuran-2-yl)methyl]propan-1-amine.
| Compound Name | 3-butoxy-N,N-bis[(5-methylfuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 5171820 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-butoxy-N,N-bis[(5-methylfuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCCOCCCN(Cc1ccc(C)o1)Cc1ccc(C)o1 |
| InChI | InChI=1S/C19H29NO3/c1-4-5-12-21-13-6-11-20(14-18-9-7-16(2)22-18)15-19-10-8-17(3)23-19/h7-10H,4-6,11-15H2,1-3H3 |
| InChIKey | LMALMAAJJJXUNW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|