About deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde
deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde (PubChem CID 158565928) has the molecular formula C14H20F2O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde.
Molecular Properties
| Compound Name | deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde |
| PubChem CID | 158565928 |
| Molecular Formula | C14H20F2O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde |
| SMILES | CF.Cc1ccc(C)o1.O=Cc1ccc(CO)o1.[2H]CF |
| InChI | InChI=1S/C6H6O3.C6H8O.2CH3F/c7-3-5-1-2-6(4-8)9-5;1-5-3-4-6(2)7-5;2*1-2/h1-3,8H,4H2;3-4H,1-2H3;2*1H3/i;;1D; |
| InChIKey | HRLYHEUGJJSUIL-XZVVQQHRSA-N |
| XLogP | 3.65 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde?
The IUPAC name of deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde (CID 158565928) is deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde.
What is the SMILES notation for deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde?
The canonical SMILES for deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde is CF.Cc1ccc(C)o1.O=Cc1ccc(CO)o1.[2H]CF.
What is the InChIKey of deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde?
The InChIKey is HRLYHEUGJJSUIL-XZVVQQHRSA-N. The full InChI is InChI=1S/C6H6O3.C6H8O.2CH3F/c7-3-5-1-2-6(4-8)9-5;1-5-3-4-6(2)7-5;2*1-2/h1-3,8H,4H2;3-4H,1-2H3;2*1H3/i;;1D;.
What are the key properties of deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde?
deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde has a molecular weight of 291.31 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for deuterio(fluoro)methane;2,5-dimethylfuran;fluoromethane;5-(hydroxymethyl)furan-2-carbaldehyde is sourced from PubChem (CID 158565928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).