C21H26O5 — CID 71384501
1,11-bis(5-methylfuran-2-yl)undecane-3,6,9-trione (PubChem CID 71384501) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is 1,11-bis(5-methylfuran-2-yl)undecane-3,6,9-trione.
| Compound Name | 1,11-bis(5-methylfuran-2-yl)undecane-3,6,9-trione |
|---|---|
| PubChem CID | 71384501 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1,11-bis(5-methylfuran-2-yl)undecane-3,6,9-trione |
| SMILES | Cc1ccc(CCC(=O)CCC(=O)CCC(=O)CCc2ccc(C)o2)o1 |
| InChI | InChI=1S/C21H26O5/c1-15-3-11-20(25-15)13-9-18(23)7-5-17(22)6-8-19(24)10-14-21-12-4-16(2)26-21/h3-4,11-12H,5-10,13-14H2,1-2H3 |
| InChIKey | YFMIQLVZQGXKBH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |