C15H20O4 — CID 154620502
10-(5-methylfuran-2-yl)decane-2,5,8-trione (PubChem CID 154620502) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 10-(5-methylfuran-2-yl)decane-2,5,8-trione.
| Compound Name | 10-(5-methylfuran-2-yl)decane-2,5,8-trione |
|---|---|
| PubChem CID | 154620502 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 10-(5-methylfuran-2-yl)decane-2,5,8-trione |
| SMILES | CC(=O)CCC(=O)CCC(=O)CCc1ccc(C)o1 |
| InChI | InChI=1S/C15H20O4/c1-11(16)3-5-13(17)6-7-14(18)8-10-15-9-4-12(2)19-15/h4,9H,3,5-8,10H2,1-2H3 |
| InChIKey | CBGXWQVHUZMGJX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |